C26H30O6 — CID 155795147
8,8-dimethyl-3-(2-prop-2-enoxy-4-propoxyphenyl)-2,4-dihydropyrano[2,3-f]chromene-3,4-diol (PubChem CID 155795147) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 8,8-dimethyl-3-(2-prop-2-enoxy-4-propoxyphenyl)-2,4-dihydropyrano[2,3-f]chromene-3,4-diol.
| Compound Name | 8,8-dimethyl-3-(2-prop-2-enoxy-4-propoxyphenyl)-2,4-dihydropyrano[2,3-f]chromene-3,4-diol |
|---|---|
| PubChem CID | 155795147 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 8,8-dimethyl-3-(2-prop-2-enoxy-4-propoxyphenyl)-2,4-dihydropyrano[2,3-f]chromene-3,4-diol |
| SMILES | C=CCOc1cc(OCCC)ccc1C1(O)COc2c(ccc3c2C=CC(C)(C)O3)C1O |
| InChI | InChI=1S/C26H30O6/c1-5-13-29-17-7-9-20(22(15-17)30-14-6-2)26(28)16-31-23-18-11-12-25(3,4)32-21(18)10-8-19(23)24(26)27/h6-12,15,24,27-28H,2,5,13-14,16H2,1,3-4H3 |
| InChIKey | OQSVQFXDNRLRBS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|