C24H28O6 — CID 130437454
(3R,4S)-2-ethyl-3-(2-hydroxy-4,5-dimethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-4-ol (PubChem CID 130437454) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (3R,4S)-2-ethyl-3-(2-hydroxy-4,5-dimethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-4-ol.
| Compound Name | (3R,4S)-2-ethyl-3-(2-hydroxy-4,5-dimethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-4-ol |
|---|---|
| PubChem CID | 130437454 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3R,4S)-2-ethyl-3-(2-hydroxy-4,5-dimethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-4-ol |
| SMILES | CCC1Oc2c(ccc3c2C=CC(C)(C)O3)[C@@H](O)[C@H]1c1cc(OC)c(OC)cc1O |
| InChI | InChI=1S/C24H28O6/c1-6-17-21(15-11-19(27-4)20(28-5)12-16(15)25)22(26)14-7-8-18-13(23(14)29-17)9-10-24(2,3)30-18/h7-12,17,21-22,25-26H,6H2,1-5H3/t17?,21-,22+/m0/s1 |
| InChIKey | ZDSWSDORYBDBHY-UOKKUGRISA-N |
| XLogP | 4.58 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |