C26H28O5 — CID 11133568
(2S,10S)-6-methoxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-10-ol (PubChem CID 11133568) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2S,10S)-6-methoxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-10-ol.
| Compound Name | (2S,10S)-6-methoxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-10-ol |
|---|---|
| PubChem CID | 11133568 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (2S,10S)-6-methoxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-10-ol |
| SMILES | COc1ccc2c(c1CC=C(C)C)O[C@H]1c3cc4c(cc3OC[C@@]21O)OC(C)(C)C=C4 |
| InChI | InChI=1S/C26H28O5/c1-15(2)6-7-17-20(28-5)9-8-19-23(17)30-24-18-12-16-10-11-25(3,4)31-21(16)13-22(18)29-14-26(19,24)27/h6,8-13,24,27H,7,14H2,1-5H3/t24-,26+/m0/s1 |
| InChIKey | KSXMILLEKYOTIP-AZGAKELHSA-N |
| XLogP | 5.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|