C30H32O5 — CID 56665483
7,7,19,19-tetramethyl-23-(3-methylbut-2-enyl)-8,12,20,25-tetraoxahexacyclo[12.11.0.02,11.04,9.015,24.016,21]pentacosa-2(11),3,5,9,15,17,21,23-octaen-22-ol (PubChem CID 56665483) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is 7,7,19,19-tetramethyl-23-(3-methylbut-2-enyl)-8,12,20,25-tetraoxahexacyclo[12.11.0.02,11.04,9.015,24.016,21]pentacosa-2(11),3,5,9,15,17,21,23-octaen-22-ol.
| Compound Name | 7,7,19,19-tetramethyl-23-(3-methylbut-2-enyl)-8,12,20,25-tetraoxahexacyclo[12.11.0.02,11.04,9.015,24.016,21]pentacosa-2(11),3,5,9,15,17,21,23-octaen-22-ol |
|---|---|
| PubChem CID | 56665483 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 7,7,19,19-tetramethyl-23-(3-methylbut-2-enyl)-8,12,20,25-tetraoxahexacyclo[12.11.0.02,11.04,9.015,24.016,21]pentacosa-2(11),3,5,9,15,17,21,23-octaen-22-ol |
| SMILES | CC(C)=CCc1c(O)c2c(c3c1OC1c4cc5c(cc4OCC31)OC(C)(C)C=C5)C=CC(C)(C)O2 |
| InChI | InChI=1S/C30H32O5/c1-16(2)7-8-19-25(31)28-18(10-12-30(5,6)35-28)24-21-15-32-23-14-22-17(9-11-29(3,4)34-22)13-20(23)26(21)33-27(19)24/h7,9-14,21,26,31H,8,15H2,1-6H3 |
| InChIKey | MYOQMGSQVOTIII-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|