C25H26O5 — CID 56667700
17,17-dimethyl-8-(3-methylbut-2-enyl)-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(21),5(10),6,8,13,15,19-heptaene-7,20-diol (PubChem CID 56667700) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 17,17-dimethyl-8-(3-methylbut-2-enyl)-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(21),5(10),6,8,13,15,19-heptaene-7,20-diol.
| Compound Name | 17,17-dimethyl-8-(3-methylbut-2-enyl)-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(21),5(10),6,8,13,15,19-heptaene-7,20-diol |
|---|---|
| PubChem CID | 56667700 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 17,17-dimethyl-8-(3-methylbut-2-enyl)-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(21),5(10),6,8,13,15,19-heptaene-7,20-diol |
| SMILES | CC(C)=CCc1cc2c(cc1O)OCC1c3cc(O)c4c(c3OC21)C=CC(C)(C)O4 |
| InChI | InChI=1S/C25H26O5/c1-13(2)5-6-14-9-17-21(11-19(14)26)28-12-18-16-10-20(27)24-15(22(16)29-23(17)18)7-8-25(3,4)30-24/h5,7-11,18,23,26-27H,6,12H2,1-4H3 |
| InChIKey | RUXZLRGFTZAFJO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|