C21H18O6 — CID 162818563
(1S,14S)-7,7-dimethyl-6,12,19,21,24-pentaoxahexacyclo[12.10.0.02,11.05,10.015,23.018,22]tetracosa-2,4,8,10,15(23),16,18(22)-heptaen-4-ol (PubChem CID 162818563) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is (1S,14S)-7,7-dimethyl-6,12,19,21,24-pentaoxahexacyclo[12.10.0.02,11.05,10.015,23.018,22]tetracosa-2,4,8,10,15(23),16,18(22)-heptaen-4-ol.
| Compound Name | (1S,14S)-7,7-dimethyl-6,12,19,21,24-pentaoxahexacyclo[12.10.0.02,11.05,10.015,23.018,22]tetracosa-2,4,8,10,15(23),16,18(22)-heptaen-4-ol |
|---|---|
| PubChem CID | 162818563 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (1S,14S)-7,7-dimethyl-6,12,19,21,24-pentaoxahexacyclo[12.10.0.02,11.05,10.015,23.018,22]tetracosa-2,4,8,10,15(23),16,18(22)-heptaen-4-ol |
| SMILES | CC1(C)C=Cc2c(c(O)cc3c2OC[C@@H]2c4ccc5c(c4O[C@H]32)OCO5)O1 |
| InChI | InChI=1S/C21H18O6/c1-21(2)6-5-11-16-12(7-14(22)18(11)27-21)17-13(8-23-16)10-3-4-15-20(19(10)26-17)25-9-24-15/h3-7,13,17,22H,8-9H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | XBRRZWFABQTPSY-CXAGYDPISA-N |
| XLogP | 3.91 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |