C17H14O5 — CID 162958693
(1R,12R)-16-methoxy-6,8,11,19-tetraoxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene (PubChem CID 162958693) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is (1R,12R)-16-methoxy-6,8,11,19-tetraoxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene.
| Compound Name | (1R,12R)-16-methoxy-6,8,11,19-tetraoxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene |
|---|---|
| PubChem CID | 162958693 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (1R,12R)-16-methoxy-6,8,11,19-tetraoxapentacyclo[10.8.0.02,10.05,9.013,18]icosa-2(10),3,5(9),13(18),14,16-hexaene |
| SMILES | COc1ccc2c(c1)OC[C@H]1c3ccc4c(c3O[C@@H]21)OCO4 |
| InChI | InChI=1S/C17H14O5/c1-18-9-2-3-11-14(6-9)19-7-12-10-4-5-13-17(21-8-20-13)16(10)22-15(11)12/h2-6,12,15H,7-8H2,1H3/t12-,15-/m0/s1 |
| InChIKey | SLEPYIDGMPDTFO-WFASDCNBSA-N |
| XLogP | 3.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |