C17H12O6 — CID 5316887
(1S,13R)-6,8,11,17,19,23-hexaoxahexacyclo[11.10.0.02,10.05,9.014,22.016,20]tricosa-2(10),3,5(9),14,16(20),21-hexaene (PubChem CID 5316887) has the molecular formula C17H12O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is (1S,13R)-6,8,11,17,19,23-hexaoxahexacyclo[11.10.0.02,10.05,9.014,22.016,20]tricosa-2(10),3,5(9),14,16(20),21-hexaene.
| Compound Name | (1S,13R)-6,8,11,17,19,23-hexaoxahexacyclo[11.10.0.02,10.05,9.014,22.016,20]tricosa-2(10),3,5(9),14,16(20),21-hexaene |
|---|---|
| PubChem CID | 5316887 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (1S,13R)-6,8,11,17,19,23-hexaoxahexacyclo[11.10.0.02,10.05,9.014,22.016,20]tricosa-2(10),3,5(9),14,16(20),21-hexaene |
| SMILES | c1c2c(cc3c1O[C@@H]1c4ccc5c(c4OC[C@@H]31)OCO5)OCO2 |
| InChI | InChI=1S/C17H12O6/c1-2-11-17(22-7-19-11)16-8(1)15-10(5-18-16)9-3-13-14(21-6-20-13)4-12(9)23-15/h1-4,10,15H,5-7H2/t10-,15+/m0/s1 |
| InChIKey | XEVNFKSGEIUCCG-ZUZCIYMTSA-N |
| XLogP | 2.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |