C20H20O7 — CID 38354090
(1S,5S,6R,13S)-7,7-dimethyl-8,12,20-trioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2,4(9),10,14(19),15,17-hexaene-5,6,17,18-tetrol (PubChem CID 38354090) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1S,5S,6R,13S)-7,7-dimethyl-8,12,20-trioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2,4(9),10,14(19),15,17-hexaene-5,6,17,18-tetrol.
| Compound Name | (1S,5S,6R,13S)-7,7-dimethyl-8,12,20-trioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2,4(9),10,14(19),15,17-hexaene-5,6,17,18-tetrol |
|---|---|
| PubChem CID | 38354090 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (1S,5S,6R,13S)-7,7-dimethyl-8,12,20-trioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2,4(9),10,14(19),15,17-hexaene-5,6,17,18-tetrol |
| SMILES | CC1(C)Oc2cc3c(cc2[C@H](O)[C@H]1O)[C@H]1COc2c(ccc(O)c2O)[C@H]1O3 |
| InChI | InChI=1S/C20H20O7/c1-20(2)19(24)15(22)10-5-9-11-7-25-18-8(3-4-12(21)16(18)23)17(11)26-13(9)6-14(10)27-20/h3-6,11,15,17,19,21-24H,7H2,1-2H3/t11-,15+,17-,19-/m1/s1 |
| InChIKey | RGIISVKEAPGRAD-LXKZXHBYSA-N |
| XLogP | 2.27 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|