C19H20O7 — CID 162852583
(6aR,11aR)-3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol (PubChem CID 162852583) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is (6aR,11aR)-3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol.
| Compound Name | (6aR,11aR)-3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol |
|---|---|
| PubChem CID | 162852583 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (6aR,11aR)-3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol |
| SMILES | COc1ccc2c(c1OC)OC[C@H]1c3cc(O)c(OC)c(OC)c3O[C@@H]21 |
| InChI | InChI=1S/C19H20O7/c1-21-13-6-5-9-14-11(8-25-15(9)18(13)23-3)10-7-12(20)17(22-2)19(24-4)16(10)26-14/h5-7,11,14,20H,8H2,1-4H3/t11-,14-/m0/s1 |
| InChIKey | AAAQSJHHXMDZCO-FZMZJTMJSA-N |
| XLogP | 3.04 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |