C23H24O4 — CID 91993519
[5,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-phenylmethanone (PubChem CID 91993519) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is [5,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-phenylmethanone.
| Compound Name | [5,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 91993519 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [5,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-phenylmethanone |
| SMILES | CC(C)=CCc1c(O)c(C(=O)c2ccccc2)c(O)c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C23H24O4/c1-14(2)10-11-16-20(25)18(19(24)15-8-6-5-7-9-15)21(26)17-12-13-23(3,4)27-22(16)17/h5-10,12-13,25-26H,11H2,1-4H3 |
| InChIKey | SPMYLENUNIKPSS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|