C27H29NO7 — CID 167082513
1-[2,4-bis(prop-2-enoxy)phenyl]-2-[7-methoxy-2,2-dimethyl-6-(nitrosomethyl)chromen-5-yl]oxyethanone (PubChem CID 167082513) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is 1-[2,4-bis(prop-2-enoxy)phenyl]-2-[7-methoxy-2,2-dimethyl-6-(nitrosomethyl)chromen-5-yl]oxyethanone.
| Compound Name | 1-[2,4-bis(prop-2-enoxy)phenyl]-2-[7-methoxy-2,2-dimethyl-6-(nitrosomethyl)chromen-5-yl]oxyethanone |
|---|---|
| PubChem CID | 167082513 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[2,4-bis(prop-2-enoxy)phenyl]-2-[7-methoxy-2,2-dimethyl-6-(nitrosomethyl)chromen-5-yl]oxyethanone |
| SMILES | C=CCOc1ccc(C(=O)COc2c3c(cc(OC)c2CN=O)OC(C)(C)C=C3)c(OCC=C)c1 |
| InChI | InChI=1S/C27H29NO7/c1-6-12-32-18-8-9-19(24(14-18)33-13-7-2)22(29)17-34-26-20-10-11-27(3,4)35-25(20)15-23(31-5)21(26)16-28-30/h6-11,14-15H,1-2,12-13,16-17H2,3-5H3 |
| InChIKey | HBQBBKZWMGDSTI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|