C15H16O4 — CID 162951359
(6-acetyl-2,2-dimethylchromen-5-yl) acetate (PubChem CID 162951359) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (6-acetyl-2,2-dimethylchromen-5-yl) acetate.
| Compound Name | (6-acetyl-2,2-dimethylchromen-5-yl) acetate |
|---|---|
| PubChem CID | 162951359 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (6-acetyl-2,2-dimethylchromen-5-yl) acetate |
| SMILES | CC(=O)Oc1c(C(C)=O)ccc2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C15H16O4/c1-9(16)11-5-6-13-12(14(11)18-10(2)17)7-8-15(3,4)19-13/h5-8H,1-4H3 |
| InChIKey | SHZKOKMCMINUAK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|