C24H22O7 — CID 163028461
[3-acetyloxy-4-(4-methoxy-7,7-dimethylfuro[3,2-g]chromen-2-yl)phenyl] acetate (PubChem CID 163028461) has the molecular formula C24H22O7 and a molecular weight of 422.43 g/mol. Its IUPAC name is [3-acetyloxy-4-(4-methoxy-7,7-dimethylfuro[3,2-g]chromen-2-yl)phenyl] acetate.
| Compound Name | [3-acetyloxy-4-(4-methoxy-7,7-dimethylfuro[3,2-g]chromen-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 163028461 |
| Molecular Formula | C24H22O7 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [3-acetyloxy-4-(4-methoxy-7,7-dimethylfuro[3,2-g]chromen-2-yl)phenyl] acetate |
| SMILES | COc1c2c(cc3oc(-c4ccc(OC(C)=O)cc4OC(C)=O)cc13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C24H22O7/c1-13(25)28-15-6-7-16(19(10-15)29-14(2)26)20-11-18-21(30-20)12-22-17(23(18)27-5)8-9-24(3,4)31-22/h6-12H,1-5H3 |
| InChIKey | ZESBXWGYLACNBK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|