C22H26O3 — CID 130368831
(3E,5Z)-1-(5-methoxy-2,2-dimethylchromen-6-yl)-3,6-dimethylocta-3,5,7-trien-1-one (PubChem CID 130368831) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3E,5Z)-1-(5-methoxy-2,2-dimethylchromen-6-yl)-3,6-dimethylocta-3,5,7-trien-1-one.
| Compound Name | (3E,5Z)-1-(5-methoxy-2,2-dimethylchromen-6-yl)-3,6-dimethylocta-3,5,7-trien-1-one |
|---|---|
| PubChem CID | 130368831 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3E,5Z)-1-(5-methoxy-2,2-dimethylchromen-6-yl)-3,6-dimethylocta-3,5,7-trien-1-one |
| SMILES | C=C/C(C)=C\C=C(/C)CC(=O)c1ccc2c(c1OC)C=CC(C)(C)O2 |
| InChI | InChI=1S/C22H26O3/c1-7-15(2)8-9-16(3)14-19(23)17-10-11-20-18(21(17)24-6)12-13-22(4,5)25-20/h7-13H,1,14H2,2-6H3/b15-8-,16-9+ |
| InChIKey | MILIIDKRSCWZJA-IZKYPSLPSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|