C24H24O6 — CID 11292723
4-(3,4-dimethoxyphenoxy)-1-(5-methoxy-2,2-dimethylchromen-6-yl)but-2-yn-1-one (PubChem CID 11292723) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenoxy)-1-(5-methoxy-2,2-dimethylchromen-6-yl)but-2-yn-1-one.
| Compound Name | 4-(3,4-dimethoxyphenoxy)-1-(5-methoxy-2,2-dimethylchromen-6-yl)but-2-yn-1-one |
|---|---|
| PubChem CID | 11292723 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenoxy)-1-(5-methoxy-2,2-dimethylchromen-6-yl)but-2-yn-1-one |
| SMILES | COc1ccc(OCC#CC(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)cc1OC |
| InChI | InChI=1S/C24H24O6/c1-24(2)13-12-18-20(30-24)11-9-17(23(18)28-5)19(25)7-6-14-29-16-8-10-21(26-3)22(15-16)27-4/h8-13,15H,14H2,1-5H3 |
| InChIKey | AFYSUDGTPSUCPG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|