C28H36N2O5 — CID 147002071
5-methoxy-N-[3-methoxy-4-(3-piperidin-4-ylpropoxy)phenyl]-2,2-dimethylchromene-6-carboxamide (PubChem CID 147002071) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 5-methoxy-N-[3-methoxy-4-(3-piperidin-4-ylpropoxy)phenyl]-2,2-dimethylchromene-6-carboxamide.
| Compound Name | 5-methoxy-N-[3-methoxy-4-(3-piperidin-4-ylpropoxy)phenyl]-2,2-dimethylchromene-6-carboxamide |
|---|---|
| PubChem CID | 147002071 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 5-methoxy-N-[3-methoxy-4-(3-piperidin-4-ylpropoxy)phenyl]-2,2-dimethylchromene-6-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)ccc1OCCCC1CCNCC1 |
| InChI | InChI=1S/C28H36N2O5/c1-28(2)14-11-21-23(35-28)10-8-22(26(21)33-4)27(31)30-20-7-9-24(25(18-20)32-3)34-17-5-6-19-12-15-29-16-13-19/h7-11,14,18-19,29H,5-6,12-13,15-17H2,1-4H3,(H,30,31) |
| InChIKey | ASFOOJBKSXBNTR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|