C17H16O4 — CID 11087308
7-(4-methoxyphenyl)-2,2-dimethylpyrano[4,3-b]pyran-5-one (PubChem CID 11087308) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-2,2-dimethylpyrano[4,3-b]pyran-5-one.
| Compound Name | 7-(4-methoxyphenyl)-2,2-dimethylpyrano[4,3-b]pyran-5-one |
|---|---|
| PubChem CID | 11087308 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 7-(4-methoxyphenyl)-2,2-dimethylpyrano[4,3-b]pyran-5-one |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)C=CC(C)(C)O3)cc1 |
| InChI | InChI=1S/C17H16O4/c1-17(2)9-8-13-15(21-17)10-14(20-16(13)18)11-4-6-12(19-3)7-5-11/h4-10H,1-3H3 |
| InChIKey | TZTJEUZYPBTKTD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |