C21H22O7S — CID 175355398
[5-methoxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxychromen-6-yl]methyl formate (PubChem CID 175355398) has the molecular formula C21H22O7S and a molecular weight of 418.47 g/mol. Its IUPAC name is [5-methoxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxychromen-6-yl]methyl formate.
| Compound Name | [5-methoxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxychromen-6-yl]methyl formate |
|---|---|
| PubChem CID | 175355398 |
| Molecular Formula | C21H22O7S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [5-methoxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxychromen-6-yl]methyl formate |
| SMILES | COc1c2c(cc(OS(=O)(=O)c3ccc(C)cc3)c1COC=O)OC(C)(C)C=C2 |
| InChI | InChI=1S/C21H22O7S/c1-14-5-7-15(8-6-14)29(23,24)28-19-11-18-16(9-10-21(2,3)27-18)20(25-4)17(19)12-26-13-22/h5-11,13H,12H2,1-4H3 |
| InChIKey | ZYZIACMKFKBHCN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|