C25H23NO4S — CID 134846188
(2,2,7-trimethyl-10H-pyrano[3,2-h]carbazol-9-yl) 4-methylbenzenesulfonate (PubChem CID 134846188) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is (2,2,7-trimethyl-10H-pyrano[3,2-h]carbazol-9-yl) 4-methylbenzenesulfonate.
| Compound Name | (2,2,7-trimethyl-10H-pyrano[3,2-h]carbazol-9-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134846188 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (2,2,7-trimethyl-10H-pyrano[3,2-h]carbazol-9-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(C)cc3c2[nH]c2cc4c(cc23)C=CC(C)(C)O4)cc1 |
| InChI | InChI=1S/C25H23NO4S/c1-15-5-7-18(8-6-15)31(27,28)30-23-12-16(2)11-20-19-13-17-9-10-25(3,4)29-22(17)14-21(19)26-24(20)23/h5-14,26H,1-4H3 |
| InChIKey | VPNLBZXQLPDEOY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|