C28H28O8S — CID 53305202
[3-(5,8-dimethoxy-2,2-dimethylchromene-6-carbonyl)-4-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 53305202) has the molecular formula C28H28O8S and a molecular weight of 524.59 g/mol. Its IUPAC name is [3-(5,8-dimethoxy-2,2-dimethylchromene-6-carbonyl)-4-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(5,8-dimethoxy-2,2-dimethylchromene-6-carbonyl)-4-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 53305202 |
| Molecular Formula | C28H28O8S |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [3-(5,8-dimethoxy-2,2-dimethylchromene-6-carbonyl)-4-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1C(=O)c1cc(OC)c2c(c1OC)C=CC(C)(C)O2 |
| InChI | InChI=1S/C28H28O8S/c1-17-7-10-19(11-8-17)37(30,31)36-18-9-12-23(32-4)21(15-18)25(29)22-16-24(33-5)27-20(26(22)34-6)13-14-28(2,3)35-27/h7-16H,1-6H3 |
| InChIKey | VSWYMZVQXWJIGU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|