C34H28O10S3 — CID 54269064
[4-[2,4-bis-(4-methylphenyl)sulfonyloxybenzoyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 54269064) has the molecular formula C34H28O10S3 and a molecular weight of 692.79 g/mol. Its IUPAC name is [4-[2,4-bis-(4-methylphenyl)sulfonyloxybenzoyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[2,4-bis-(4-methylphenyl)sulfonyloxybenzoyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54269064 |
| Molecular Formula | C34H28O10S3 |
| Molecular Weight | 692.79 g/mol |
| Exact Mass | 692.08 |
| IUPAC Name | [4-[2,4-bis-(4-methylphenyl)sulfonyloxybenzoyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(=O)c3ccc(OS(=O)(=O)c4ccc(C)cc4)cc3OS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H28O10S3/c1-23-4-15-29(16-5-23)45(36,37)42-27-12-10-26(11-13-27)34(35)32-21-14-28(43-46(38,39)30-17-6-24(2)7-18-30)22-33(32)44-47(40,41)31-19-8-25(3)9-20-31/h4-22H,1-3H3 |
| InChIKey | RIWDQLRMKAROKS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.79 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|