C36H34O8S — CID 139561631
[4-[2-(6-formyl-2,2-dimethylchromen-5-yl)oxyacetyl]-3-phenylmethoxyphenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 139561631) has the molecular formula C36H34O8S and a molecular weight of 626.73 g/mol. Its IUPAC name is [4-[2-(6-formyl-2,2-dimethylchromen-5-yl)oxyacetyl]-3-phenylmethoxyphenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [4-[2-(6-formyl-2,2-dimethylchromen-5-yl)oxyacetyl]-3-phenylmethoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 139561631 |
| Molecular Formula | C36H34O8S |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [4-[2-(6-formyl-2,2-dimethylchromen-5-yl)oxyacetyl]-3-phenylmethoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2ccc(C(=O)COc3c(C=O)ccc4c3C=CC(C)(C)O4)c(OCc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C36H34O8S/c1-23-17-24(2)35(25(3)18-23)45(39,40)44-28-12-13-29(33(19-28)41-21-26-9-7-6-8-10-26)31(38)22-42-34-27(20-37)11-14-32-30(34)15-16-36(4,5)43-32/h6-20H,21-22H2,1-5H3 |
| InChIKey | WXOFFTVGSHVBRZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|