C22H33NO2 — CID 3045464
1-[2-(2,2-dimethyl-7-pentylchromen-5-yl)oxyethyl]pyrrolidine (PubChem CID 3045464) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[2-(2,2-dimethyl-7-pentylchromen-5-yl)oxyethyl]pyrrolidine.
| Compound Name | 1-[2-(2,2-dimethyl-7-pentylchromen-5-yl)oxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 3045464 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1-[2-(2,2-dimethyl-7-pentylchromen-5-yl)oxyethyl]pyrrolidine |
| SMILES | CCCCCc1cc(OCCN2CCCC2)c2c(c1)OC(C)(C)C=C2 |
| InChI | InChI=1S/C22H33NO2/c1-4-5-6-9-18-16-20(24-15-14-23-12-7-8-13-23)19-10-11-22(2,3)25-21(19)17-18/h10-11,16-17H,4-9,12-15H2,1-3H3 |
| InChIKey | SWHQWEREGJQYKL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|