C26H37NO4 — CID 21433910
(7-hexyl-4,4-dimethyl-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) 2-morpholin-4-ylacetate (PubChem CID 21433910) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is (7-hexyl-4,4-dimethyl-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) 2-morpholin-4-ylacetate.
| Compound Name | (7-hexyl-4,4-dimethyl-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) 2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 21433910 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | (7-hexyl-4,4-dimethyl-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl) 2-morpholin-4-ylacetate |
| SMILES | CCCCCCc1cc(OC(=O)CN2CCOCC2)c2c(c1)OC(C)(C)C1=C2CCC1 |
| InChI | InChI=1S/C26H37NO4/c1-4-5-6-7-9-19-16-22(30-24(28)18-27-12-14-29-15-13-27)25-20-10-8-11-21(20)26(2,3)31-23(25)17-19/h16-17H,4-15,18H2,1-3H3 |
| InChIKey | JSYPLVMSAWJJJM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|