C36H56N2O4 — CID 54035541
[2-(2-cyclohexylethyl)-5,5-dimethyl-8-pentyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 5-morpholin-4-ylpentanoate (PubChem CID 54035541) has the molecular formula C36H56N2O4 and a molecular weight of 580.85 g/mol. Its IUPAC name is [2-(2-cyclohexylethyl)-5,5-dimethyl-8-pentyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 5-morpholin-4-ylpentanoate.
| Compound Name | [2-(2-cyclohexylethyl)-5,5-dimethyl-8-pentyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 5-morpholin-4-ylpentanoate |
|---|---|
| PubChem CID | 54035541 |
| Molecular Formula | C36H56N2O4 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.42 |
| IUPAC Name | [2-(2-cyclohexylethyl)-5,5-dimethyl-8-pentyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 5-morpholin-4-ylpentanoate |
| SMILES | CCCCCc1cc(OC(=O)CCCCN2CCOCC2)c2c(c1)OC(C)(C)C1=C2CN(CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C36H56N2O4/c1-4-5-7-14-29-25-32(41-34(39)15-10-11-18-37-21-23-40-24-22-37)35-30-27-38(19-16-28-12-8-6-9-13-28)20-17-31(30)36(2,3)42-33(35)26-29/h25-26,28H,4-24,27H2,1-3H3 |
| InChIKey | LIRMILCGURWRDZ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|