C31H47NO4S — CID 21433914
[5,5-dimethyl-8-(3-methyloctan-2-yl)-2,3-dihydro-1H-thiopyrano[2,3-c]chromen-10-yl] 4-morpholin-4-ylbutanoate (PubChem CID 21433914) has the molecular formula C31H47NO4S and a molecular weight of 529.79 g/mol. Its IUPAC name is [5,5-dimethyl-8-(3-methyloctan-2-yl)-2,3-dihydro-1H-thiopyrano[2,3-c]chromen-10-yl] 4-morpholin-4-ylbutanoate.
| Compound Name | [5,5-dimethyl-8-(3-methyloctan-2-yl)-2,3-dihydro-1H-thiopyrano[2,3-c]chromen-10-yl] 4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 21433914 |
| Molecular Formula | C31H47NO4S |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | [5,5-dimethyl-8-(3-methyloctan-2-yl)-2,3-dihydro-1H-thiopyrano[2,3-c]chromen-10-yl] 4-morpholin-4-ylbutanoate |
| SMILES | CCCCCC(C)C(C)c1cc(OC(=O)CCCN2CCOCC2)c2c(c1)OC(C)(C)C1=C2CCCS1 |
| InChI | InChI=1S/C31H47NO4S/c1-6-7-8-11-22(2)23(3)24-20-26(35-28(33)13-9-14-32-15-17-34-18-16-32)29-25-12-10-19-37-30(25)31(4,5)36-27(29)21-24/h20-23H,6-19H2,1-5H3 |
| InChIKey | KOPZEJXBILUZKC-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|