C33H53NO3 — CID 76965071
[(9R)-6,6,9-trimethyl-3-[(2S)-nonan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(diethylamino)butanoate (PubChem CID 76965071) has the molecular formula C33H53NO3 and a molecular weight of 511.79 g/mol. Its IUPAC name is [(9R)-6,6,9-trimethyl-3-[(2S)-nonan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(diethylamino)butanoate.
| Compound Name | [(9R)-6,6,9-trimethyl-3-[(2S)-nonan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(diethylamino)butanoate |
|---|---|
| PubChem CID | 76965071 |
| Molecular Formula | C33H53NO3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | [(9R)-6,6,9-trimethyl-3-[(2S)-nonan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(diethylamino)butanoate |
| SMILES | CCCCCCC[C@H](C)c1cc(OC(=O)CCCN(CC)CC)c2c(c1)OC(C)(C)C1=C2C[C@H](C)CC1 |
| InChI | InChI=1S/C33H53NO3/c1-8-11-12-13-14-16-25(5)26-22-29(36-31(35)17-15-20-34(9-2)10-3)32-27-21-24(4)18-19-28(27)33(6,7)37-30(32)23-26/h22-25H,8-21H2,1-7H3/t24-,25+/m1/s1 |
| InChIKey | UDQAWRWPAGUCRX-RPBOFIJWSA-N |
| XLogP | 8.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|