C29H33FO4 — CID 54551347
[3-[5-(4-fluorophenyl)pentan-2-yl]-6,6,9-trimethyl-7-oxo-9,10-dihydro-8H-benzo[c]chromen-1-yl] acetate (PubChem CID 54551347) has the molecular formula C29H33FO4 and a molecular weight of 464.58 g/mol. Its IUPAC name is [3-[5-(4-fluorophenyl)pentan-2-yl]-6,6,9-trimethyl-7-oxo-9,10-dihydro-8H-benzo[c]chromen-1-yl] acetate.
| Compound Name | [3-[5-(4-fluorophenyl)pentan-2-yl]-6,6,9-trimethyl-7-oxo-9,10-dihydro-8H-benzo[c]chromen-1-yl] acetate |
|---|---|
| PubChem CID | 54551347 |
| Molecular Formula | C29H33FO4 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [3-[5-(4-fluorophenyl)pentan-2-yl]-6,6,9-trimethyl-7-oxo-9,10-dihydro-8H-benzo[c]chromen-1-yl] acetate |
| SMILES | CC(=O)Oc1cc(C(C)CCCc2ccc(F)cc2)cc2c1C1=C(C(=O)CC(C)C1)C(C)(C)O2 |
| InChI | InChI=1S/C29H33FO4/c1-17-13-23-27-25(33-19(3)31)15-21(16-26(27)34-29(4,5)28(23)24(32)14-17)18(2)7-6-8-20-9-11-22(30)12-10-20/h9-12,15-18H,6-8,13-14H2,1-5H3 |
| InChIKey | ZKCPXMAHTMKUAW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|