C30H38FNO4 — CID 131709906
cyclobutyl-[8-[5-(4-fluorophenyl)pentan-2-yl]-10,10-dihydroxy-5,5-dimethyl-1,3,4,4a-tetrahydrochromeno[4,3-c]pyridin-2-yl]methanone (PubChem CID 131709906) has the molecular formula C30H38FNO4 and a molecular weight of 495.64 g/mol. Its IUPAC name is cyclobutyl-[8-[5-(4-fluorophenyl)pentan-2-yl]-10,10-dihydroxy-5,5-dimethyl-1,3,4,4a-tetrahydrochromeno[4,3-c]pyridin-2-yl]methanone.
| Compound Name | cyclobutyl-[8-[5-(4-fluorophenyl)pentan-2-yl]-10,10-dihydroxy-5,5-dimethyl-1,3,4,4a-tetrahydrochromeno[4,3-c]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 131709906 |
| Molecular Formula | C30H38FNO4 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | cyclobutyl-[8-[5-(4-fluorophenyl)pentan-2-yl]-10,10-dihydroxy-5,5-dimethyl-1,3,4,4a-tetrahydrochromeno[4,3-c]pyridin-2-yl]methanone |
| SMILES | CC(CCCc1ccc(F)cc1)C1=CC(O)(O)C2=C3CN(C(=O)C4CCC4)CCC3C(C)(C)OC2=C1 |
| InChI | InChI=1S/C30H38FNO4/c1-19(6-4-7-20-10-12-23(31)13-11-20)22-16-26-27(30(34,35)17-22)24-18-32(28(33)21-8-5-9-21)15-14-25(24)29(2,3)36-26/h10-13,16-17,19,21,25,34-35H,4-9,14-15,18H2,1-3H3 |
| InChIKey | JNAGGKCOPOJAKX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|