C22H31FN2O — CID 95543541
cyclopropyl-[4-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]piperidin-1-yl]methanone (PubChem CID 95543541) has the molecular formula C22H31FN2O and a molecular weight of 358.50 g/mol. Its IUPAC name is cyclopropyl-[4-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95543541 |
| Molecular Formula | C22H31FN2O |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | cyclopropyl-[4-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(N2CCC[C@H](CCc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C22H31FN2O/c23-20-9-5-17(6-10-20)3-4-18-2-1-13-25(16-18)21-11-14-24(15-12-21)22(26)19-7-8-19/h5-6,9-10,18-19,21H,1-4,7-8,11-16H2/t18-/m1/s1 |
| InChIKey | CFYTYTSLRMGEEW-GOSISDBHSA-N |
| XLogP | 3.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |