C36H45FN2O4 — CID 88767419
[8-[5-(4-fluorophenyl)pentyl]-5,5-dimethyl-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate (PubChem CID 88767419) has the molecular formula C36H45FN2O4 and a molecular weight of 588.76 g/mol. Its IUPAC name is [8-[5-(4-fluorophenyl)pentyl]-5,5-dimethyl-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate.
| Compound Name | [8-[5-(4-fluorophenyl)pentyl]-5,5-dimethyl-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 88767419 |
| Molecular Formula | C36H45FN2O4 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | [8-[5-(4-fluorophenyl)pentyl]-5,5-dimethyl-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate |
| SMILES | C#CCN1CCC2=C(C1)c1c(OC(=O)CCCN3CCOCC3)cc(CCCCCc3ccc(F)cc3)cc1OC2(C)C |
| InChI | InChI=1S/C36H45FN2O4/c1-4-17-39-19-16-31-30(26-39)35-32(42-34(40)11-8-18-38-20-22-41-23-21-38)24-28(25-33(35)43-36(31,2)3)10-7-5-6-9-27-12-14-29(37)15-13-27/h1,12-15,24-25H,5-11,16-23,26H2,2-3H3 |
| InChIKey | KBSRWUCFHPLLOY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|