C35H55NO3 — CID 76957071
[(9R)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(azepan-1-yl)butanoate (PubChem CID 76957071) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is [(9R)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(azepan-1-yl)butanoate.
| Compound Name | [(9R)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(azepan-1-yl)butanoate |
|---|---|
| PubChem CID | 76957071 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | [(9R)-6,6,9-trimethyl-3-[(2R,3S)-3-methyloctan-2-yl]-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl] 4-(azepan-1-yl)butanoate |
| SMILES | CCCCC[C@H](C)[C@@H](C)c1cc(OC(=O)CCCN2CCCCCC2)c2c(c1)OC(C)(C)C1=C2C[C@H](C)CC1 |
| InChI | InChI=1S/C35H55NO3/c1-7-8-11-15-26(3)27(4)28-23-31(38-33(37)16-14-21-36-19-12-9-10-13-20-36)34-29-22-25(2)17-18-30(29)35(5,6)39-32(34)24-28/h23-27H,7-22H2,1-6H3/t25-,26+,27-/m1/s1 |
| InChIKey | DRVZFWZGQKGHQO-KWXIBIRDSA-N |
| XLogP | 9.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|