C32H51ClN2O4 — CID 21499410
[2,5,5-trimethyl-8-(3-methyloctan-2-yl)-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;hydrochloride (PubChem CID 21499410) has the molecular formula C32H51ClN2O4 and a molecular weight of 563.22 g/mol. Its IUPAC name is [2,5,5-trimethyl-8-(3-methyloctan-2-yl)-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;hydrochloride.
| Compound Name | [2,5,5-trimethyl-8-(3-methyloctan-2-yl)-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 21499410 |
| Molecular Formula | C32H51ClN2O4 |
| Molecular Weight | 563.22 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | [2,5,5-trimethyl-8-(3-methyloctan-2-yl)-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;hydrochloride |
| SMILES | CCCCCC(C)C(C)c1cc(OC(=O)CCCN2CCOCC2)c2c(c1)OC(C)(C)C1=C2CN(C)CC1.Cl |
| InChI | InChI=1S/C32H50N2O4.ClH/c1-7-8-9-11-23(2)24(3)25-20-28(37-30(35)12-10-14-34-16-18-36-19-17-34)31-26-22-33(6)15-13-27(26)32(4,5)38-29(31)21-25;/h20-21,23-24H,7-19,22H2,1-6H3;1H |
| InChIKey | ROOJANPNQKNTGK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.22 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|