C32H52BrNO3S — CID 86733785
[2,2,4,4-tetramethyl-7-(3-methyloctan-2-yl)-3a,9b-dihydro-1H-thieno[2,3-c]chromen-9-yl] 4-pyrrolidin-1-ylbutanoate;hydrobromide (PubChem CID 86733785) has the molecular formula C32H52BrNO3S and a molecular weight of 610.74 g/mol. Its IUPAC name is [2,2,4,4-tetramethyl-7-(3-methyloctan-2-yl)-3a,9b-dihydro-1H-thieno[2,3-c]chromen-9-yl] 4-pyrrolidin-1-ylbutanoate;hydrobromide.
| Compound Name | [2,2,4,4-tetramethyl-7-(3-methyloctan-2-yl)-3a,9b-dihydro-1H-thieno[2,3-c]chromen-9-yl] 4-pyrrolidin-1-ylbutanoate;hydrobromide |
|---|---|
| PubChem CID | 86733785 |
| Molecular Formula | C32H52BrNO3S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | [2,2,4,4-tetramethyl-7-(3-methyloctan-2-yl)-3a,9b-dihydro-1H-thieno[2,3-c]chromen-9-yl] 4-pyrrolidin-1-ylbutanoate;hydrobromide |
| SMILES | Br.CCCCCC(C)C(C)c1cc(OC(=O)CCCN2CCCC2)c2c(c1)OC(C)(C)C1SC(C)(C)CC21 |
| InChI | InChI=1S/C32H51NO3S.BrH/c1-8-9-10-14-22(2)23(3)24-19-26(35-28(34)15-13-18-33-16-11-12-17-33)29-25-21-31(4,5)37-30(25)32(6,7)36-27(29)20-24;/h19-20,22-23,25,30H,8-18,21H2,1-7H3;1H |
| InChIKey | JDXJPTLEDRMRIN-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|