C20H33NO2 — CID 57199457
5-(3-methyloctan-2-yl)-2-piperidin-1-ylbenzene-1,3-diol (PubChem CID 57199457) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 5-(3-methyloctan-2-yl)-2-piperidin-1-ylbenzene-1,3-diol.
| Compound Name | 5-(3-methyloctan-2-yl)-2-piperidin-1-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 57199457 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 5-(3-methyloctan-2-yl)-2-piperidin-1-ylbenzene-1,3-diol |
| SMILES | CCCCCC(C)C(C)c1cc(O)c(N2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C20H33NO2/c1-4-5-7-10-15(2)16(3)17-13-18(22)20(19(23)14-17)21-11-8-6-9-12-21/h13-16,22-23H,4-12H2,1-3H3 |
| InChIKey | GTKURWRUKHPVQK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|