C24H33NO3 — CID 54156421
N-[[2,6-dihydroxy-4-(3-methyloctan-2-yl)phenyl]-phenylmethyl]acetamide (PubChem CID 54156421) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is N-[[2,6-dihydroxy-4-(3-methyloctan-2-yl)phenyl]-phenylmethyl]acetamide.
| Compound Name | N-[[2,6-dihydroxy-4-(3-methyloctan-2-yl)phenyl]-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 54156421 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | N-[[2,6-dihydroxy-4-(3-methyloctan-2-yl)phenyl]-phenylmethyl]acetamide |
| SMILES | CCCCCC(C)C(C)c1cc(O)c(C(NC(C)=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C24H33NO3/c1-5-6-8-11-16(2)17(3)20-14-21(27)23(22(28)15-20)24(25-18(4)26)19-12-9-7-10-13-19/h7,9-10,12-17,24,27-28H,5-6,8,11H2,1-4H3,(H,25,26) |
| InChIKey | OLJITSOACKIBPS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|