C26H40O2 — CID 154377540
9-ethyl-6,6-dimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 154377540) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 9-ethyl-6,6-dimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 9-ethyl-6,6-dimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 154377540 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 9-ethyl-6,6-dimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCC(C)C(C)c1cc(O)c2c(c1)OC(C)(C)C1=C2CC(CC)CC1 |
| InChI | InChI=1S/C26H40O2/c1-7-9-10-11-17(3)18(4)20-15-23(27)25-21-14-19(8-2)12-13-22(21)26(5,6)28-24(25)16-20/h15-19,27H,7-14H2,1-6H3 |
| InChIKey | WNYMCRVLLQMWMI-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|