C23H35NO2 — CID 70563792
5,5-dimethyl-8-(3-methyloctyl)-1,2,3,4-tetrahydrochromeno[4,3-c]pyridin-10-ol (PubChem CID 70563792) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 5,5-dimethyl-8-(3-methyloctyl)-1,2,3,4-tetrahydrochromeno[4,3-c]pyridin-10-ol.
| Compound Name | 5,5-dimethyl-8-(3-methyloctyl)-1,2,3,4-tetrahydrochromeno[4,3-c]pyridin-10-ol |
|---|---|
| PubChem CID | 70563792 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 5,5-dimethyl-8-(3-methyloctyl)-1,2,3,4-tetrahydrochromeno[4,3-c]pyridin-10-ol |
| SMILES | CCCCCC(C)CCc1cc(O)c2c(c1)OC(C)(C)C1=C2CNCC1 |
| InChI | InChI=1S/C23H35NO2/c1-5-6-7-8-16(2)9-10-17-13-20(25)22-18-15-24-12-11-19(18)23(3,4)26-21(22)14-17/h13-14,16,24-25H,5-12,15H2,1-4H3 |
| InChIKey | JWNOBPHCJSHCSV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|