C21H30O4 — CID 172516483
(8S,9R)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,8,9-triol (PubChem CID 172516483) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (8S,9R)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,8,9-triol.
| Compound Name | (8S,9R)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,8,9-triol |
|---|---|
| PubChem CID | 172516483 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (8S,9R)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,8,9-triol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)C1=C2C[C@@](C)(O)[C@@H](O)C1 |
| InChI | InChI=1S/C21H30O4/c1-5-6-7-8-13-9-16(22)19-14-12-21(4,24)18(23)11-15(14)20(2,3)25-17(19)10-13/h9-10,18,22-24H,5-8,11-12H2,1-4H3/t18-,21+/m0/s1 |
| InChIKey | WEVYNIJDEFFKLF-GHTZIAJQSA-N |
| XLogP | 3.96 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|