C22H32O2 — CID 131983359
2,2,3-trimethyl-4-(2-methylprop-1-enyl)-8-pentyl-5H-1-benzoxepin-6-ol (PubChem CID 131983359) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2,2,3-trimethyl-4-(2-methylprop-1-enyl)-8-pentyl-5H-1-benzoxepin-6-ol.
| Compound Name | 2,2,3-trimethyl-4-(2-methylprop-1-enyl)-8-pentyl-5H-1-benzoxepin-6-ol |
|---|---|
| PubChem CID | 131983359 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2,2,3-trimethyl-4-(2-methylprop-1-enyl)-8-pentyl-5H-1-benzoxepin-6-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)C(C)=C(C=C(C)C)C2 |
| InChI | InChI=1S/C22H32O2/c1-7-8-9-10-17-12-20(23)19-14-18(11-15(2)3)16(4)22(5,6)24-21(19)13-17/h11-13,23H,7-10,14H2,1-6H3 |
| InChIKey | LVDCWLMMXFZPCK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|