C20H28O2S — CID 21433925
7-heptan-2-yl-4,4-dimethyl-1,2-dihydrothieno[2,3-c]chromen-9-ol (PubChem CID 21433925) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is 7-heptan-2-yl-4,4-dimethyl-1,2-dihydrothieno[2,3-c]chromen-9-ol.
| Compound Name | 7-heptan-2-yl-4,4-dimethyl-1,2-dihydrothieno[2,3-c]chromen-9-ol |
|---|---|
| PubChem CID | 21433925 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 7-heptan-2-yl-4,4-dimethyl-1,2-dihydrothieno[2,3-c]chromen-9-ol |
| SMILES | CCCCCC(C)c1cc(O)c2c(c1)OC(C)(C)C1=C2CCS1 |
| InChI | InChI=1S/C20H28O2S/c1-5-6-7-8-13(2)14-11-16(21)18-15-9-10-23-19(15)20(3,4)22-17(18)12-14/h11-13,21H,5-10H2,1-4H3 |
| InChIKey | JFVIJUQPVLJBLN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|