C24H31NO2 — CID 44522939
2,2-dimethyl-7-octan-2-yl-4-pyridin-4-ylchromen-5-ol (PubChem CID 44522939) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2,2-dimethyl-7-octan-2-yl-4-pyridin-4-ylchromen-5-ol.
| Compound Name | 2,2-dimethyl-7-octan-2-yl-4-pyridin-4-ylchromen-5-ol |
|---|---|
| PubChem CID | 44522939 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 2,2-dimethyl-7-octan-2-yl-4-pyridin-4-ylchromen-5-ol |
| SMILES | CCCCCCC(C)c1cc(O)c2c(c1)OC(C)(C)C=C2c1ccncc1 |
| InChI | InChI=1S/C24H31NO2/c1-5-6-7-8-9-17(2)19-14-21(26)23-20(18-10-12-25-13-11-18)16-24(3,4)27-22(23)15-19/h10-17,26H,5-9H2,1-4H3 |
| InChIKey | OEPFQUBYNBPKEK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|