C30H39NO2 — CID 44522573
4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-7-heptan-2-yl-2,2-dimethylchromen-5-ol (PubChem CID 44522573) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is 4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-7-heptan-2-yl-2,2-dimethylchromen-5-ol.
| Compound Name | 4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-7-heptan-2-yl-2,2-dimethylchromen-5-ol |
|---|---|
| PubChem CID | 44522573 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-7-heptan-2-yl-2,2-dimethylchromen-5-ol |
| SMILES | CCCCCC(C)c1cc(O)c2c(c1)OC(C)(C)C=C2C1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H39NO2/c1-5-6-8-11-22(2)25-18-27(32)29-26(20-30(3,4)33-28(29)19-25)24-14-16-31(17-15-24)21-23-12-9-7-10-13-23/h7,9-10,12-14,18-20,22,32H,5-6,8,11,15-17,21H2,1-4H3 |
| InChIKey | RVTTYHSALMSRNP-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|