C31H34ClNO3 — CID 21438576
2-benzyl-10-hydroxy-8-[5-(4-methylphenyl)pentan-2-yl]-3,4-dihydro-1H-chromeno[4,3-c]pyridin-5-one;hydrochloride (PubChem CID 21438576) has the molecular formula C31H34ClNO3 and a molecular weight of 504.07 g/mol. Its IUPAC name is 2-benzyl-10-hydroxy-8-[5-(4-methylphenyl)pentan-2-yl]-3,4-dihydro-1H-chromeno[4,3-c]pyridin-5-one;hydrochloride.
| Compound Name | 2-benzyl-10-hydroxy-8-[5-(4-methylphenyl)pentan-2-yl]-3,4-dihydro-1H-chromeno[4,3-c]pyridin-5-one;hydrochloride |
|---|---|
| PubChem CID | 21438576 |
| Molecular Formula | C31H34ClNO3 |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-benzyl-10-hydroxy-8-[5-(4-methylphenyl)pentan-2-yl]-3,4-dihydro-1H-chromeno[4,3-c]pyridin-5-one;hydrochloride |
| SMILES | Cc1ccc(CCCC(C)c2cc(O)c3c4c(c(=O)oc3c2)CCN(Cc2ccccc2)C4)cc1.Cl |
| InChI | InChI=1S/C31H33NO3.ClH/c1-21-11-13-23(14-12-21)10-6-7-22(2)25-17-28(33)30-27-20-32(19-24-8-4-3-5-9-24)16-15-26(27)31(34)35-29(30)18-25;/h3-5,8-9,11-14,17-18,22,33H,6-7,10,15-16,19-20H2,1-2H3;1H |
| InChIKey | QXBRAGKHDBRJEU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|