C25H27NO5 — CID 10025186
ethyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate (PubChem CID 10025186) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate.
| Compound Name | ethyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate |
|---|---|
| PubChem CID | 10025186 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | ethyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate |
| SMILES | CCOC(=O)CC(C)c1cc(O)c2c3c(c(=O)oc2c1)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C25H27NO5/c1-3-30-23(28)11-16(2)18-12-21(27)24-20-15-26(14-17-7-5-4-6-8-17)10-9-19(20)25(29)31-22(24)13-18/h4-8,12-13,16,27H,3,9-11,14-15H2,1-2H3 |
| InChIKey | YEIUBIGZDBQKGT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|