C26H29NO5 — CID 11812138
propyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate (PubChem CID 11812138) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is propyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate.
| Compound Name | propyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate |
|---|---|
| PubChem CID | 11812138 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | propyl 3-(2-benzyl-10-hydroxy-5-oxo-3,4-dihydro-1H-chromeno[4,3-c]pyridin-8-yl)butanoate |
| SMILES | CCCOC(=O)CC(C)c1cc(O)c2c3c(c(=O)oc2c1)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C26H29NO5/c1-3-11-31-24(29)12-17(2)19-13-22(28)25-21-16-27(15-18-7-5-4-6-8-18)10-9-20(21)26(30)32-23(25)14-19/h4-8,13-14,17,28H,3,9-12,15-16H2,1-2H3 |
| InChIKey | IDDJJRWKKRQAIF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|