C29H34N2O4S — CID 4132520
ethyl 6-benzyl-2-[(4-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 4132520) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is ethyl 6-benzyl-2-[(4-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 6-benzyl-2-[(4-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4132520 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | ethyl 6-benzyl-2-[(4-pentoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCCCCOc1ccc(C(=O)Nc2sc3c(c2C(=O)OCC)CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-3-5-9-18-35-23-14-12-22(13-15-23)27(32)30-28-26(29(33)34-4-2)24-16-17-31(20-25(24)36-28)19-21-10-7-6-8-11-21/h6-8,10-15H,3-5,9,16-20H2,1-2H3,(H,30,32) |
| InChIKey | BYANJFLWQBHBQD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|