C24H23IN2O3S — CID 2429393
ethyl 6-benzyl-2-[(2-iodobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 2429393) has the molecular formula C24H23IN2O3S and a molecular weight of 546.43 g/mol. Its IUPAC name is ethyl 6-benzyl-2-[(2-iodobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 6-benzyl-2-[(2-iodobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2429393 |
| Molecular Formula | C24H23IN2O3S |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | ethyl 6-benzyl-2-[(2-iodobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2I)sc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H23IN2O3S/c1-2-30-24(29)21-18-12-13-27(14-16-8-4-3-5-9-16)15-20(18)31-23(21)26-22(28)17-10-6-7-11-19(17)25/h3-11H,2,12-15H2,1H3,(H,26,28) |
| InChIKey | CDWAEISNQPSGRP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|