C24H21ClF2N2O3S — CID 2342299
ethyl 6-benzyl-2-[(2-chloro-4,5-difluorobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 2342299) has the molecular formula C24H21ClF2N2O3S and a molecular weight of 490.96 g/mol. Its IUPAC name is ethyl 6-benzyl-2-[(2-chloro-4,5-difluorobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 6-benzyl-2-[(2-chloro-4,5-difluorobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2342299 |
| Molecular Formula | C24H21ClF2N2O3S |
| Molecular Weight | 490.96 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | ethyl 6-benzyl-2-[(2-chloro-4,5-difluorobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc(F)c(F)cc2Cl)sc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H21ClF2N2O3S/c1-2-32-24(31)21-15-8-9-29(12-14-6-4-3-5-7-14)13-20(15)33-23(21)28-22(30)16-10-18(26)19(27)11-17(16)25/h3-7,10-11H,2,8-9,12-13H2,1H3,(H,28,30) |
| InChIKey | ACMPJVJNXQFVQA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|